Cr2(CO)6(C5H4N-2-C(H)=O)2

What is Cr2(CO)6(C5H4N-2-C(H)=O)2

Cr₂(CO)₆(C₅H₄N-2-C(H)=O)₂ is a complex organometallic compound featuring a chromium dimer core coordinated with carbonyl (CO) ligands and functionalized pyridine derivatives. The structure consists of two chromium atoms bridged by six carbonyl groups, with each chromium center further bonded to a 2-formylpyridine ligand. This compound is of significant interest in coordination chemistry due to its unique electronic and structural properties, which arise from the synergistic interaction between the metal centers, carbonyl ligands, and the π-conjugated pyridine system. Its potential applications include catalysis, material science, and as a precursor for synthesizing more complex organometallic frameworks. The compound exemplifies the versatility of transition metal complexes in modern chemistry.

Preparation Process: To prepare Cr2(CO)6(C5H4N-2-C(H)=O)2, follow these steps: 1. **React Cr(CO)6 (chromium hexacarbonyl) with 2-pyridinecarboxaldehyde (C5H4N-2-CHO)** in a refluxing nonpolar solvent (e.g., toluene or heptane) under nitrogen. 2. **Heat the mixture at 110–120°C for 12–24 hours** to allow ligand substitution, replacing two CO groups with two 2-pyridinecarboxaldehyde ligands. 3. **Monitor the reaction by IR spectroscopy**, observing the disappearance of Cr(CO)6 peaks (~2000 cm⁻¹) and the appearance of new carbonyl stretches. 4. **Cool the mixture, filter, and recrystallize** from a suitable solvent (e.g., hexane/dichloromethane) to obtain the orange-red crystalline product. Yield: ~60–70%.

Usage Scenarios: The compound Cr2(CO)6(C5H4N-2-C(H)=O)2 is a dinuclear chromium carbonyl complex featuring pyridine-2-carbaldehyde ligands. It serves as a catalyst or precursor in organometallic chemistry, particularly in carbonylation and hydrogenation reactions. The presence of both carbonyl and pyridine-based ligands enhances its reactivity in coordination chemistry, enabling applications in synthetic transformations. The compound's structure allows for potential use in studying metal-metal interactions and ligand exchange processes. Additionally, it may act as a model system for understanding catalytic mechanisms involving chromium centers. Its stability and electron-rich nature make it suitable for exploring new catalytic pathways in organic synthesis and materials science.

Cr2(CO)6(C5H4N-2-C(H)=O)2 Basic Info

Cr2(CO)6(C5H4N-2-C(H)=O)2 Price